C12H11F2NO2 — CID 134615287
2-[6-cyano-2-(difluoromethyl)-3-ethylphenyl]acetic acid (PubChem CID 134615287) has the molecular formula C12H11F2NO2 and a molecular weight of 239.22 g/mol. Its IUPAC name is 2-[6-cyano-2-(difluoromethyl)-3-ethylphenyl]acetic acid.
| Compound Name | 2-[6-cyano-2-(difluoromethyl)-3-ethylphenyl]acetic acid |
|---|---|
| PubChem CID | 134615287 |
| Molecular Formula | C12H11F2NO2 |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 2-[6-cyano-2-(difluoromethyl)-3-ethylphenyl]acetic acid |
| SMILES | CCc1ccc(C#N)c(CC(=O)O)c1C(F)F |
| InChI | InChI=1S/C12H11F2NO2/c1-2-7-3-4-8(6-15)9(5-10(16)17)11(7)12(13)14/h3-4,12H,2,5H2,1H3,(H,16,17) |
| InChIKey | ANNKWWAWZHVKIX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |