2-(3-cyano-2,6-diethylphenyl)acetic acid

C13H15NO2 — CID 135742920

IUPAC2-(3-cyano-2,6-diethylphenyl)acetic acid
SMILESCCc1ccc(C#N)c(CC)c1CC(=O)O
InChIInChI=1S/C13H15NO2/c1-3-9-5-6-10(8-14)11(4-2)12(9)7-13(15)16/h5-6H,3-4,7H2,1-2H3,(H,15,16)
InChIKeyFSVDFIYEXMRUFX-UHFFFAOYSA-N
MW217.27 g/mol
LogP2.31
Rot. Bonds4

About 2-(3-cyano-2,6-diethylphenyl)acetic acid

2-(3-cyano-2,6-diethylphenyl)acetic acid (PubChem CID 135742920) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-(3-cyano-2,6-diethylphenyl)acetic acid.

Molecular Properties

Compound Name2-(3-cyano-2,6-diethylphenyl)acetic acid
PubChem CID135742920
Molecular FormulaC13H15NO2
Molecular Weight217.27 g/mol
Exact Mass217.11
IUPAC Name2-(3-cyano-2,6-diethylphenyl)acetic acid
SMILESCCc1ccc(C#N)c(CC)c1CC(=O)O
InChIInChI=1S/C13H15NO2/c1-3-9-5-6-10(8-14)11(4-2)12(9)7-13(15)16/h5-6H,3-4,7H2,1-2H3,(H,15,16)
InChIKeyFSVDFIYEXMRUFX-UHFFFAOYSA-N
XLogP2.31
TPSA61.09 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.27
LogP ≤ 52.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(3-cyano-2,6-diethylphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[3-cyano-2-ethyl-6-(hydroxymethyl)phenyl]acetic acid
CID 135742914
2,3,4-triethylbenzonitrile
CID 22750758
2-(3-cyano-2-ethyl-6-formylphenyl)acetic acid
CID 135742903
2-(6-cyano-2-ethyl-3-nitrophenyl)acetic acid
CID 134615279
2-[6-cyano-2-(difluoromethyl)-3-ethylphenyl]acetic acid
CID 134615287
2-(2-cyano-3,6-diethylphenyl)acetic acid
CID 119014105
2-[3-cyano-6-(difluoromethoxy)-2-ethylphenyl]acetic acid
CID 135742929
2-[3-cyano-6-ethyl-2-(trifluoromethoxy)phenyl]acetic acid
CID 135743047
2-(6-cyano-2-fluoro-3-methylphenyl)acetic acid
CID 131168116
2-[4-cyano-3-(hydroxymethyl)-2-methylphenyl]acetic acid
CID 118827501
ethyl 2-[2-(aminomethyl)-4-cyano-3-ethylphenyl]acetate
CID 134652210
methyl 6-cyano-2,3-diethylbenzoate
CID 134613355

Frequently Asked Questions

What is the IUPAC name of 2-(3-cyano-2,6-diethylphenyl)acetic acid?
The IUPAC name of 2-(3-cyano-2,6-diethylphenyl)acetic acid (CID 135742920) is 2-(3-cyano-2,6-diethylphenyl)acetic acid.
What is the SMILES notation for 2-(3-cyano-2,6-diethylphenyl)acetic acid?
The canonical SMILES for 2-(3-cyano-2,6-diethylphenyl)acetic acid is CCc1ccc(C#N)c(CC)c1CC(=O)O.
What is the InChIKey of 2-(3-cyano-2,6-diethylphenyl)acetic acid?
The InChIKey is FSVDFIYEXMRUFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2/c1-3-9-5-6-10(8-14)11(4-2)12(9)7-13(15)16/h5-6H,3-4,7H2,1-2H3,(H,15,16).
What are the key properties of 2-(3-cyano-2,6-diethylphenyl)acetic acid?
2-(3-cyano-2,6-diethylphenyl)acetic acid has a molecular weight of 217.27 g/mol, XLogP of 2.31, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-cyano-2,6-diethylphenyl)acetic acid is sourced from PubChem (CID 135742920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).