C10H9BrClF3S — CID 134616553
1-bromo-3-(3-chloropropyl)-2-(trifluoromethylsulfanyl)benzene (PubChem CID 134616553) has the molecular formula C10H9BrClF3S and a molecular weight of 333.60 g/mol. Its IUPAC name is 1-bromo-3-(3-chloropropyl)-2-(trifluoromethylsulfanyl)benzene.
| Compound Name | 1-bromo-3-(3-chloropropyl)-2-(trifluoromethylsulfanyl)benzene |
|---|---|
| PubChem CID | 134616553 |
| Molecular Formula | C10H9BrClF3S |
| Molecular Weight | 333.60 g/mol |
| Exact Mass | 331.92 |
| IUPAC Name | 1-bromo-3-(3-chloropropyl)-2-(trifluoromethylsulfanyl)benzene |
| SMILES | FC(F)(F)Sc1c(Br)cccc1CCCCl |
| InChI | InChI=1S/C10H9BrClF3S/c11-8-5-1-3-7(4-2-6-12)9(8)16-10(13,14)15/h1,3,5H,2,4,6H2 |
| InChIKey | JIKSCGZJDCLISH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.60 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|