C11H11Cl2F3S — CID 134628678
2-(chloromethyl)-4-(3-chloropropyl)-1-(trifluoromethylsulfanyl)benzene (PubChem CID 134628678) has the molecular formula C11H11Cl2F3S and a molecular weight of 303.18 g/mol. Its IUPAC name is 2-(chloromethyl)-4-(3-chloropropyl)-1-(trifluoromethylsulfanyl)benzene.
| Compound Name | 2-(chloromethyl)-4-(3-chloropropyl)-1-(trifluoromethylsulfanyl)benzene |
|---|---|
| PubChem CID | 134628678 |
| Molecular Formula | C11H11Cl2F3S |
| Molecular Weight | 303.18 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 2-(chloromethyl)-4-(3-chloropropyl)-1-(trifluoromethylsulfanyl)benzene |
| SMILES | FC(F)(F)Sc1ccc(CCCCl)cc1CCl |
| InChI | InChI=1S/C11H11Cl2F3S/c12-5-1-2-8-3-4-10(9(6-8)7-13)17-11(14,15)16/h3-4,6H,1-2,5,7H2 |
| InChIKey | FJKZLGJCLKXHON-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.18 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|