C10H9F6NO — CID 134617609
[5-methoxy-2,3-bis(trifluoromethyl)phenyl]methanamine (PubChem CID 134617609) has the molecular formula C10H9F6NO and a molecular weight of 273.18 g/mol. Its IUPAC name is [5-methoxy-2,3-bis(trifluoromethyl)phenyl]methanamine.
| Compound Name | [5-methoxy-2,3-bis(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 134617609 |
| Molecular Formula | C10H9F6NO |
| Molecular Weight | 273.18 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | [5-methoxy-2,3-bis(trifluoromethyl)phenyl]methanamine |
| SMILES | COc1cc(CN)c(C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H9F6NO/c1-18-6-2-5(4-17)8(10(14,15)16)7(3-6)9(11,12)13/h2-3H,4,17H2,1H3 |
| InChIKey | WYCDYQBTOYCNQP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.18 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |