C10H7F6NO2 — CID 118854542
5-methoxy-2,3-bis(trifluoromethyl)benzamide (PubChem CID 118854542) has the molecular formula C10H7F6NO2 and a molecular weight of 287.16 g/mol. Its IUPAC name is 5-methoxy-2,3-bis(trifluoromethyl)benzamide.
| Compound Name | 5-methoxy-2,3-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 118854542 |
| Molecular Formula | C10H7F6NO2 |
| Molecular Weight | 287.16 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 5-methoxy-2,3-bis(trifluoromethyl)benzamide |
| SMILES | COc1cc(C(N)=O)c(C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H7F6NO2/c1-19-4-2-5(8(17)18)7(10(14,15)16)6(3-4)9(11,12)13/h2-3H,1H3,(H2,17,18) |
| InChIKey | VACQFIKSDYRPDT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.16 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |