C13H6Cl2F3I — CID 134617667
1,2-dichloro-3-[4-iodo-3-(trifluoromethyl)phenyl]benzene (PubChem CID 134617667) has the molecular formula C13H6Cl2F3I and a molecular weight of 417.00 g/mol. Its IUPAC name is 1,2-dichloro-3-[4-iodo-3-(trifluoromethyl)phenyl]benzene.
| Compound Name | 1,2-dichloro-3-[4-iodo-3-(trifluoromethyl)phenyl]benzene |
|---|---|
| PubChem CID | 134617667 |
| Molecular Formula | C13H6Cl2F3I |
| Molecular Weight | 417.00 g/mol |
| Exact Mass | 415.88 |
| IUPAC Name | 1,2-dichloro-3-[4-iodo-3-(trifluoromethyl)phenyl]benzene |
| SMILES | FC(F)(F)c1cc(-c2cccc(Cl)c2Cl)ccc1I |
| InChI | InChI=1S/C13H6Cl2F3I/c14-10-3-1-2-8(12(10)15)7-4-5-11(19)9(6-7)13(16,17)18/h1-6H |
| InChIKey | ZMHPNWNFJJNRPG-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.00 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|