C17H10Cl2F3NO3 — CID 71616677
methyl 6-(2,3-dichlorophenyl)-1-hydroxy-4-(trifluoromethyl)indole-2-carboxylate (PubChem CID 71616677) has the molecular formula C17H10Cl2F3NO3 and a molecular weight of 404.17 g/mol. Its IUPAC name is methyl 6-(2,3-dichlorophenyl)-1-hydroxy-4-(trifluoromethyl)indole-2-carboxylate.
| Compound Name | methyl 6-(2,3-dichlorophenyl)-1-hydroxy-4-(trifluoromethyl)indole-2-carboxylate |
|---|---|
| PubChem CID | 71616677 |
| Molecular Formula | C17H10Cl2F3NO3 |
| Molecular Weight | 404.17 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | methyl 6-(2,3-dichlorophenyl)-1-hydroxy-4-(trifluoromethyl)indole-2-carboxylate |
| SMILES | COC(=O)c1cc2c(C(F)(F)F)cc(-c3cccc(Cl)c3Cl)cc2n1O |
| InChI | InChI=1S/C17H10Cl2F3NO3/c1-26-16(24)14-7-10-11(17(20,21)22)5-8(6-13(10)23(14)25)9-3-2-4-12(18)15(9)19/h2-7,25H,1H3 |
| InChIKey | JZPNTWBGPORHFJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.17 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|