C12H2Cl5F3IN — CID 134620489
2-iodo-3-(2,3,4,5,6-pentachlorophenyl)-4-(trifluoromethyl)pyridine (PubChem CID 134620489) has the molecular formula C12H2Cl5F3IN and a molecular weight of 521.32 g/mol. Its IUPAC name is 2-iodo-3-(2,3,4,5,6-pentachlorophenyl)-4-(trifluoromethyl)pyridine.
| Compound Name | 2-iodo-3-(2,3,4,5,6-pentachlorophenyl)-4-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 134620489 |
| Molecular Formula | C12H2Cl5F3IN |
| Molecular Weight | 521.32 g/mol |
| Exact Mass | 518.76 |
| IUPAC Name | 2-iodo-3-(2,3,4,5,6-pentachlorophenyl)-4-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1ccnc(I)c1-c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12H2Cl5F3IN/c13-6-5(7(14)9(16)10(17)8(6)15)4-3(12(18,19)20)1-2-22-11(4)21/h1-2H |
| InChIKey | BGTYFHYFABYNOX-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.32 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|