C12H4Cl5F3N2 — CID 134618434
3-(2,3,4,5,6-pentachlorophenyl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 134618434) has the molecular formula C12H4Cl5F3N2 and a molecular weight of 410.44 g/mol. Its IUPAC name is 3-(2,3,4,5,6-pentachlorophenyl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 3-(2,3,4,5,6-pentachlorophenyl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 134618434 |
| Molecular Formula | C12H4Cl5F3N2 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 407.88 |
| IUPAC Name | 3-(2,3,4,5,6-pentachlorophenyl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | Nc1nccc(C(F)(F)F)c1-c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12H4Cl5F3N2/c13-6-5(7(14)9(16)10(17)8(6)15)4-3(12(18,19)20)1-2-22-11(4)21/h1-2H,(H2,21,22) |
| InChIKey | MOJYVKFWPZJYIX-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|