C11H13F3N2 — CID 150328576
3-(1-methylcyclobutyl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 150328576) has the molecular formula C11H13F3N2 and a molecular weight of 230.23 g/mol. Its IUPAC name is 3-(1-methylcyclobutyl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 3-(1-methylcyclobutyl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 150328576 |
| Molecular Formula | C11H13F3N2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 3-(1-methylcyclobutyl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC1(c2c(C(F)(F)F)ccnc2N)CCC1 |
| InChI | InChI=1S/C11H13F3N2/c1-10(4-2-5-10)8-7(11(12,13)14)3-6-16-9(8)15/h3,6H,2,4-5H2,1H3,(H2,15,16) |
| InChIKey | GPDYYKIZRCAMSW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |