C13H7Cl3F3NO — CID 134620746
2-methoxy-4-(2,4,5-trichlorophenyl)-5-(trifluoromethyl)pyridine (PubChem CID 134620746) has the molecular formula C13H7Cl3F3NO and a molecular weight of 356.56 g/mol. Its IUPAC name is 2-methoxy-4-(2,4,5-trichlorophenyl)-5-(trifluoromethyl)pyridine.
| Compound Name | 2-methoxy-4-(2,4,5-trichlorophenyl)-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 134620746 |
| Molecular Formula | C13H7Cl3F3NO |
| Molecular Weight | 356.56 g/mol |
| Exact Mass | 354.95 |
| IUPAC Name | 2-methoxy-4-(2,4,5-trichlorophenyl)-5-(trifluoromethyl)pyridine |
| SMILES | COc1cc(-c2cc(Cl)c(Cl)cc2Cl)c(C(F)(F)F)cn1 |
| InChI | InChI=1S/C13H7Cl3F3NO/c1-21-12-3-6(8(5-20-12)13(17,18)19)7-2-10(15)11(16)4-9(7)14/h2-5H,1H3 |
| InChIKey | QVYUXMPSXUWDNC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.56 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|