C11H9F5O4 — CID 134621107
3-[2-(difluoromethoxy)-3-(trifluoromethoxy)phenyl]propanoic acid (PubChem CID 134621107) has the molecular formula C11H9F5O4 and a molecular weight of 300.18 g/mol. Its IUPAC name is 3-[2-(difluoromethoxy)-3-(trifluoromethoxy)phenyl]propanoic acid.
| Compound Name | 3-[2-(difluoromethoxy)-3-(trifluoromethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 134621107 |
| Molecular Formula | C11H9F5O4 |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 3-[2-(difluoromethoxy)-3-(trifluoromethoxy)phenyl]propanoic acid |
| SMILES | O=C(O)CCc1cccc(OC(F)(F)F)c1OC(F)F |
| InChI | InChI=1S/C11H9F5O4/c12-10(13)19-9-6(4-5-8(17)18)2-1-3-7(9)20-11(14,15)16/h1-3,10H,4-5H2,(H,17,18) |
| InChIKey | XXHSYVGFRIKFHE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |