C11H10F3NO — CID 134621531
3-[2-methyl-3-(trifluoromethoxy)phenyl]propanenitrile (PubChem CID 134621531) has the molecular formula C11H10F3NO and a molecular weight of 229.20 g/mol. Its IUPAC name is 3-[2-methyl-3-(trifluoromethoxy)phenyl]propanenitrile.
| Compound Name | 3-[2-methyl-3-(trifluoromethoxy)phenyl]propanenitrile |
|---|---|
| PubChem CID | 134621531 |
| Molecular Formula | C11H10F3NO |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 3-[2-methyl-3-(trifluoromethoxy)phenyl]propanenitrile |
| SMILES | Cc1c(CCC#N)cccc1OC(F)(F)F |
| InChI | InChI=1S/C11H10F3NO/c1-8-9(5-3-7-15)4-2-6-10(8)16-11(12,13)14/h2,4,6H,3,5H2,1H3 |
| InChIKey | XASPBPTVLNKJKW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |