C15H9Cl2FO2 — CID 134621691
(E)-3-[5-(3,5-dichlorophenyl)-2-fluorophenyl]prop-2-enoic acid (PubChem CID 134621691) has the molecular formula C15H9Cl2FO2 and a molecular weight of 311.14 g/mol. Its IUPAC name is (E)-3-[5-(3,5-dichlorophenyl)-2-fluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(3,5-dichlorophenyl)-2-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 134621691 |
| Molecular Formula | C15H9Cl2FO2 |
| Molecular Weight | 311.14 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | (E)-3-[5-(3,5-dichlorophenyl)-2-fluorophenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(-c2cc(Cl)cc(Cl)c2)ccc1F |
| InChI | InChI=1S/C15H9Cl2FO2/c16-12-6-11(7-13(17)8-12)9-1-3-14(18)10(5-9)2-4-15(19)20/h1-8H,(H,19,20)/b4-2+ |
| InChIKey | KFTUJMBRWZWJFU-DUXPYHPUSA-N |
| XLogP | 4.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.14 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|