C15H6Cl5FO2 — CID 134628162
(E)-3-[2-fluoro-5-(2,3,4,5,6-pentachlorophenyl)phenyl]prop-2-enoic acid (PubChem CID 134628162) has the molecular formula C15H6Cl5FO2 and a molecular weight of 414.47 g/mol. Its IUPAC name is (E)-3-[2-fluoro-5-(2,3,4,5,6-pentachlorophenyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-fluoro-5-(2,3,4,5,6-pentachlorophenyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 134628162 |
| Molecular Formula | C15H6Cl5FO2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 411.88 |
| IUPAC Name | (E)-3-[2-fluoro-5-(2,3,4,5,6-pentachlorophenyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)ccc1F |
| InChI | InChI=1S/C15H6Cl5FO2/c16-11-10(12(17)14(19)15(20)13(11)18)7-1-3-8(21)6(5-7)2-4-9(22)23/h1-5H,(H,22,23)/b4-2+ |
| InChIKey | UYZMQTDRIIHTCZ-DUXPYHPUSA-N |
| XLogP | 6.86 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|