C16H13F6NO — CID 134622608
2-[2-[3-(trifluoromethoxy)phenyl]-4-(trifluoromethyl)phenyl]ethanamine (PubChem CID 134622608) has the molecular formula C16H13F6NO and a molecular weight of 349.27 g/mol. Its IUPAC name is 2-[2-[3-(trifluoromethoxy)phenyl]-4-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | 2-[2-[3-(trifluoromethoxy)phenyl]-4-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 134622608 |
| Molecular Formula | C16H13F6NO |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 2-[2-[3-(trifluoromethoxy)phenyl]-4-(trifluoromethyl)phenyl]ethanamine |
| SMILES | NCCc1ccc(C(F)(F)F)cc1-c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C16H13F6NO/c17-15(18,19)12-5-4-10(6-7-23)14(9-12)11-2-1-3-13(8-11)24-16(20,21)22/h1-5,8-9H,6-7,23H2 |
| InChIKey | VSHSMNZLLXTNLT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |