C13H7Cl4NO — CID 134622766
2-chloro-6-(2,4,6-trichlorophenyl)benzamide (PubChem CID 134622766) has the molecular formula C13H7Cl4NO and a molecular weight of 335.02 g/mol. Its IUPAC name is 2-chloro-6-(2,4,6-trichlorophenyl)benzamide.
| Compound Name | 2-chloro-6-(2,4,6-trichlorophenyl)benzamide |
|---|---|
| PubChem CID | 134622766 |
| Molecular Formula | C13H7Cl4NO |
| Molecular Weight | 335.02 g/mol |
| Exact Mass | 332.93 |
| IUPAC Name | 2-chloro-6-(2,4,6-trichlorophenyl)benzamide |
| SMILES | NC(=O)c1c(Cl)cccc1-c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H7Cl4NO/c14-6-4-9(16)11(10(17)5-6)7-2-1-3-8(15)12(7)13(18)19/h1-5H,(H2,18,19) |
| InChIKey | BHVXWYKSQUBLFS-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.02 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |