C13H6Cl3FO — CID 134623207
2-(3,4-dichlorophenyl)-6-fluorobenzoyl chloride (PubChem CID 134623207) has the molecular formula C13H6Cl3FO and a molecular weight of 303.55 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-6-fluorobenzoyl chloride.
| Compound Name | 2-(3,4-dichlorophenyl)-6-fluorobenzoyl chloride |
|---|---|
| PubChem CID | 134623207 |
| Molecular Formula | C13H6Cl3FO |
| Molecular Weight | 303.55 g/mol |
| Exact Mass | 301.95 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-6-fluorobenzoyl chloride |
| SMILES | O=C(Cl)c1c(F)cccc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H6Cl3FO/c14-9-5-4-7(6-10(9)15)8-2-1-3-11(17)12(8)13(16)18/h1-6H |
| InChIKey | YQSMFJNVFCUTQT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|