C12H12BrClO2 — CID 134625122
(E)-3-[3-bromo-2-(3-chloropropyl)phenyl]prop-2-enoic acid (PubChem CID 134625122) has the molecular formula C12H12BrClO2 and a molecular weight of 303.58 g/mol. Its IUPAC name is (E)-3-[3-bromo-2-(3-chloropropyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-bromo-2-(3-chloropropyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 134625122 |
| Molecular Formula | C12H12BrClO2 |
| Molecular Weight | 303.58 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | (E)-3-[3-bromo-2-(3-chloropropyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(Br)c1CCCCl |
| InChI | InChI=1S/C12H12BrClO2/c13-11-5-1-3-9(6-7-12(15)16)10(11)4-2-8-14/h1,3,5-7H,2,4,8H2,(H,15,16)/b7-6+ |
| InChIKey | XKBNDTWAAFIUIA-VOTSOKGWSA-N |
| XLogP | 3.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.58 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|