C14H7F7 — CID 134628457
1,2,4,5-tetrafluoro-3-methyl-6-[4-(trifluoromethyl)phenyl]benzene (PubChem CID 134628457) has the molecular formula C14H7F7 and a molecular weight of 308.20 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-methyl-6-[4-(trifluoromethyl)phenyl]benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-methyl-6-[4-(trifluoromethyl)phenyl]benzene |
|---|---|
| PubChem CID | 134628457 |
| Molecular Formula | C14H7F7 |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-methyl-6-[4-(trifluoromethyl)phenyl]benzene |
| SMILES | Cc1c(F)c(F)c(-c2ccc(C(F)(F)F)cc2)c(F)c1F |
| InChI | InChI=1S/C14H7F7/c1-6-10(15)12(17)9(13(18)11(6)16)7-2-4-8(5-3-7)14(19,20)21/h2-5H,1H3 |
| InChIKey | RIERESRTWNTRSO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|