C13H8Cl4O — CID 134628956
[3-chloro-5-(2,3,6-trichlorophenyl)phenyl]methanol (PubChem CID 134628956) has the molecular formula C13H8Cl4O and a molecular weight of 322.02 g/mol. Its IUPAC name is [3-chloro-5-(2,3,6-trichlorophenyl)phenyl]methanol.
| Compound Name | [3-chloro-5-(2,3,6-trichlorophenyl)phenyl]methanol |
|---|---|
| PubChem CID | 134628956 |
| Molecular Formula | C13H8Cl4O |
| Molecular Weight | 322.02 g/mol |
| Exact Mass | 319.93 |
| IUPAC Name | [3-chloro-5-(2,3,6-trichlorophenyl)phenyl]methanol |
| SMILES | OCc1cc(Cl)cc(-c2c(Cl)ccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C13H8Cl4O/c14-9-4-7(6-18)3-8(5-9)12-10(15)1-2-11(16)13(12)17/h1-5,18H,6H2 |
| InChIKey | FQIDQVCUVOCZCH-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.02 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|