C12H5Cl3FI — CID 118804732
1,2,4-trichloro-3-(4-fluoro-3-iodophenyl)benzene (PubChem CID 118804732) has the molecular formula C12H5Cl3FI and a molecular weight of 401.43 g/mol. Its IUPAC name is 1,2,4-trichloro-3-(4-fluoro-3-iodophenyl)benzene.
| Compound Name | 1,2,4-trichloro-3-(4-fluoro-3-iodophenyl)benzene |
|---|---|
| PubChem CID | 118804732 |
| Molecular Formula | C12H5Cl3FI |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 399.85 |
| IUPAC Name | 1,2,4-trichloro-3-(4-fluoro-3-iodophenyl)benzene |
| SMILES | Fc1ccc(-c2c(Cl)ccc(Cl)c2Cl)cc1I |
| InChI | InChI=1S/C12H5Cl3FI/c13-7-2-3-8(14)12(15)11(7)6-1-4-9(16)10(17)5-6/h1-5H |
| InChIKey | IYYCVIOPOIPYAH-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|