C18H17NO2 — CID 13463177
methyl 1-benzyl-4H-quinoline-3-carboxylate (PubChem CID 13463177) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is methyl 1-benzyl-4H-quinoline-3-carboxylate.
| Compound Name | methyl 1-benzyl-4H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 13463177 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | methyl 1-benzyl-4H-quinoline-3-carboxylate |
| SMILES | COC(=O)C1=CN(Cc2ccccc2)c2ccccc2C1 |
| InChI | InChI=1S/C18H17NO2/c1-21-18(20)16-11-15-9-5-6-10-17(15)19(13-16)12-14-7-3-2-4-8-14/h2-10,13H,11-12H2,1H3 |
| InChIKey | YUSVIFSYXQOICW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |