C12H11F3N2O2S — CID 134635169
methyl 2-[4-(aminomethyl)-2-cyano-3-(trifluoromethylsulfanyl)phenyl]acetate (PubChem CID 134635169) has the molecular formula C12H11F3N2O2S and a molecular weight of 304.29 g/mol. Its IUPAC name is methyl 2-[4-(aminomethyl)-2-cyano-3-(trifluoromethylsulfanyl)phenyl]acetate.
| Compound Name | methyl 2-[4-(aminomethyl)-2-cyano-3-(trifluoromethylsulfanyl)phenyl]acetate |
|---|---|
| PubChem CID | 134635169 |
| Molecular Formula | C12H11F3N2O2S |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | methyl 2-[4-(aminomethyl)-2-cyano-3-(trifluoromethylsulfanyl)phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(CN)c(SC(F)(F)F)c1C#N |
| InChI | InChI=1S/C12H11F3N2O2S/c1-19-10(18)4-7-2-3-8(5-16)11(9(7)6-17)20-12(13,14)15/h2-3H,4-5,16H2,1H3 |
| InChIKey | YCMRAJDLXKPBBB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |