C13H13F3N2O2S — CID 134652074
ethyl 2-[2-(aminomethyl)-4-cyano-3-(trifluoromethylsulfanyl)phenyl]acetate (PubChem CID 134652074) has the molecular formula C13H13F3N2O2S and a molecular weight of 318.32 g/mol. Its IUPAC name is ethyl 2-[2-(aminomethyl)-4-cyano-3-(trifluoromethylsulfanyl)phenyl]acetate.
| Compound Name | ethyl 2-[2-(aminomethyl)-4-cyano-3-(trifluoromethylsulfanyl)phenyl]acetate |
|---|---|
| PubChem CID | 134652074 |
| Molecular Formula | C13H13F3N2O2S |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | ethyl 2-[2-(aminomethyl)-4-cyano-3-(trifluoromethylsulfanyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(C#N)c(SC(F)(F)F)c1CN |
| InChI | InChI=1S/C13H13F3N2O2S/c1-2-20-11(19)5-8-3-4-9(6-17)12(10(8)7-18)21-13(14,15)16/h3-4H,2,5,7,18H2,1H3 |
| InChIKey | IOAFARFITNSSSB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |