C13H12F3NO2S — CID 134633419
ethyl 2-[4-cyano-3-methyl-2-(trifluoromethylsulfanyl)phenyl]acetate (PubChem CID 134633419) has the molecular formula C13H12F3NO2S and a molecular weight of 303.31 g/mol. Its IUPAC name is ethyl 2-[4-cyano-3-methyl-2-(trifluoromethylsulfanyl)phenyl]acetate.
| Compound Name | ethyl 2-[4-cyano-3-methyl-2-(trifluoromethylsulfanyl)phenyl]acetate |
|---|---|
| PubChem CID | 134633419 |
| Molecular Formula | C13H12F3NO2S |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | ethyl 2-[4-cyano-3-methyl-2-(trifluoromethylsulfanyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(C#N)c(C)c1SC(F)(F)F |
| InChI | InChI=1S/C13H12F3NO2S/c1-3-19-11(18)6-9-4-5-10(7-17)8(2)12(9)20-13(14,15)16/h4-5H,3,6H2,1-2H3 |
| InChIKey | VQJRKEOWWORVHL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |