C13H10F3NO3S — CID 134653902
ethyl 2-[4-cyano-3-formyl-2-(trifluoromethylsulfanyl)phenyl]acetate (PubChem CID 134653902) has the molecular formula C13H10F3NO3S and a molecular weight of 317.29 g/mol. Its IUPAC name is ethyl 2-[4-cyano-3-formyl-2-(trifluoromethylsulfanyl)phenyl]acetate.
| Compound Name | ethyl 2-[4-cyano-3-formyl-2-(trifluoromethylsulfanyl)phenyl]acetate |
|---|---|
| PubChem CID | 134653902 |
| Molecular Formula | C13H10F3NO3S |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | ethyl 2-[4-cyano-3-formyl-2-(trifluoromethylsulfanyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(C#N)c(C=O)c1SC(F)(F)F |
| InChI | InChI=1S/C13H10F3NO3S/c1-2-20-11(19)5-8-3-4-9(6-17)10(7-18)12(8)21-13(14,15)16/h3-4,7H,2,5H2,1H3 |
| InChIKey | SVLFREURQBMWFZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|