C14H14F3NO2S — CID 134653995
ethyl 2-[6-cyano-2-ethyl-3-(trifluoromethylsulfanyl)phenyl]acetate (PubChem CID 134653995) has the molecular formula C14H14F3NO2S and a molecular weight of 317.33 g/mol. Its IUPAC name is ethyl 2-[6-cyano-2-ethyl-3-(trifluoromethylsulfanyl)phenyl]acetate.
| Compound Name | ethyl 2-[6-cyano-2-ethyl-3-(trifluoromethylsulfanyl)phenyl]acetate |
|---|---|
| PubChem CID | 134653995 |
| Molecular Formula | C14H14F3NO2S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | ethyl 2-[6-cyano-2-ethyl-3-(trifluoromethylsulfanyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1c(C#N)ccc(SC(F)(F)F)c1CC |
| InChI | InChI=1S/C14H14F3NO2S/c1-3-10-11(7-13(19)20-4-2)9(8-18)5-6-12(10)21-14(15,16)17/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | CDGWPVPBBPYTPC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |