C13H10F5NO3S — CID 134655256
ethyl 2-[3-cyano-2-(difluoromethoxy)-6-(trifluoromethylsulfanyl)phenyl]acetate (PubChem CID 134655256) has the molecular formula C13H10F5NO3S and a molecular weight of 355.28 g/mol. Its IUPAC name is ethyl 2-[3-cyano-2-(difluoromethoxy)-6-(trifluoromethylsulfanyl)phenyl]acetate.
| Compound Name | ethyl 2-[3-cyano-2-(difluoromethoxy)-6-(trifluoromethylsulfanyl)phenyl]acetate |
|---|---|
| PubChem CID | 134655256 |
| Molecular Formula | C13H10F5NO3S |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | ethyl 2-[3-cyano-2-(difluoromethoxy)-6-(trifluoromethylsulfanyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1c(SC(F)(F)F)ccc(C#N)c1OC(F)F |
| InChI | InChI=1S/C13H10F5NO3S/c1-2-21-10(20)5-8-9(23-13(16,17)18)4-3-7(6-19)11(8)22-12(14)15/h3-4,12H,2,5H2,1H3 |
| InChIKey | ZJEKZCDVYUBQCD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |