C12H11F3N2O2 — CID 134635188
methyl 2-[4-(aminomethyl)-3-cyano-5-(trifluoromethyl)phenyl]acetate (PubChem CID 134635188) has the molecular formula C12H11F3N2O2 and a molecular weight of 272.23 g/mol. Its IUPAC name is methyl 2-[4-(aminomethyl)-3-cyano-5-(trifluoromethyl)phenyl]acetate.
| Compound Name | methyl 2-[4-(aminomethyl)-3-cyano-5-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 134635188 |
| Molecular Formula | C12H11F3N2O2 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | methyl 2-[4-(aminomethyl)-3-cyano-5-(trifluoromethyl)phenyl]acetate |
| SMILES | COC(=O)Cc1cc(C#N)c(CN)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F3N2O2/c1-19-11(18)4-7-2-8(5-16)9(6-17)10(3-7)12(13,14)15/h2-3H,4,6,17H2,1H3 |
| InChIKey | SALCFQIWWLKTLX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |