C12H12F2N2O3 — CID 134658183
methyl 2-[2-(aminomethyl)-3-cyano-5-(difluoromethoxy)phenyl]acetate (PubChem CID 134658183) has the molecular formula C12H12F2N2O3 and a molecular weight of 270.24 g/mol. Its IUPAC name is methyl 2-[2-(aminomethyl)-3-cyano-5-(difluoromethoxy)phenyl]acetate.
| Compound Name | methyl 2-[2-(aminomethyl)-3-cyano-5-(difluoromethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 134658183 |
| Molecular Formula | C12H12F2N2O3 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | methyl 2-[2-(aminomethyl)-3-cyano-5-(difluoromethoxy)phenyl]acetate |
| SMILES | COC(=O)Cc1cc(OC(F)F)cc(C#N)c1CN |
| InChI | InChI=1S/C12H12F2N2O3/c1-18-11(17)4-7-2-9(19-12(13)14)3-8(5-15)10(7)6-16/h2-3,12H,4,6,16H2,1H3 |
| InChIKey | NWBKHAMFIZAXCX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |