C12H7Cl3N2O3 — CID 134636384
3-methoxy-2-nitro-6-(2,3,4-trichlorophenyl)pyridine (PubChem CID 134636384) has the molecular formula C12H7Cl3N2O3 and a molecular weight of 333.56 g/mol. Its IUPAC name is 3-methoxy-2-nitro-6-(2,3,4-trichlorophenyl)pyridine.
| Compound Name | 3-methoxy-2-nitro-6-(2,3,4-trichlorophenyl)pyridine |
|---|---|
| PubChem CID | 134636384 |
| Molecular Formula | C12H7Cl3N2O3 |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | 3-methoxy-2-nitro-6-(2,3,4-trichlorophenyl)pyridine |
| SMILES | COc1ccc(-c2ccc(Cl)c(Cl)c2Cl)nc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H7Cl3N2O3/c1-20-9-5-4-8(16-12(9)17(18)19)6-2-3-7(13)11(15)10(6)14/h2-5H,1H3 |
| InChIKey | ZQADVWNAAGJGTJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|