C9H6F6IN — CID 134638419
[2-iodo-3,4-bis(trifluoromethyl)phenyl]methanamine (PubChem CID 134638419) has the molecular formula C9H6F6IN and a molecular weight of 369.05 g/mol. Its IUPAC name is [2-iodo-3,4-bis(trifluoromethyl)phenyl]methanamine.
| Compound Name | [2-iodo-3,4-bis(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 134638419 |
| Molecular Formula | C9H6F6IN |
| Molecular Weight | 369.05 g/mol |
| Exact Mass | 368.94 |
| IUPAC Name | [2-iodo-3,4-bis(trifluoromethyl)phenyl]methanamine |
| SMILES | NCc1ccc(C(F)(F)F)c(C(F)(F)F)c1I |
| InChI | InChI=1S/C9H6F6IN/c10-8(11,12)5-2-1-4(3-17)7(16)6(5)9(13,14)15/h1-2H,3,17H2 |
| InChIKey | VIXUVPHKKOEJJP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.05 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|