About [2-iodo-3,4-bis(trifluoromethyl)phenyl]methanamine
[2-iodo-3,4-bis(trifluoromethyl)phenyl]methanamine (PubChem CID 134638419) has the molecular formula C9H6F6IN
and a molecular weight of 369.05 g/mol. Its IUPAC name is [2-iodo-3,4-bis(trifluoromethyl)phenyl]methanamine.
Molecular Properties
| Compound Name | [2-iodo-3,4-bis(trifluoromethyl)phenyl]methanamine |
| PubChem CID | 134638419 |
| Molecular Formula | C9H6F6IN |
| Molecular Weight | 369.05 g/mol |
| Exact Mass | 368.94 |
| IUPAC Name | [2-iodo-3,4-bis(trifluoromethyl)phenyl]methanamine |
| SMILES | NCc1ccc(C(F)(F)F)c(C(F)(F)F)c1I |
| InChI | InChI=1S/C9H6F6IN/c10-8(11,12)5-2-1-4(3-17)7(16)6(5)9(13,14)15/h1-2H,3,17H2 |
| InChIKey | VIXUVPHKKOEJJP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.05 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [2-iodo-3,4-bis(trifluoromethyl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-iodo-3,4-bis(trifluoromethyl)phenyl]methanamine?
The IUPAC name of [2-iodo-3,4-bis(trifluoromethyl)phenyl]methanamine (CID 134638419) is [2-iodo-3,4-bis(trifluoromethyl)phenyl]methanamine.
What is the SMILES notation for [2-iodo-3,4-bis(trifluoromethyl)phenyl]methanamine?
The canonical SMILES for [2-iodo-3,4-bis(trifluoromethyl)phenyl]methanamine is NCc1ccc(C(F)(F)F)c(C(F)(F)F)c1I.
What is the InChIKey of [2-iodo-3,4-bis(trifluoromethyl)phenyl]methanamine?
The InChIKey is VIXUVPHKKOEJJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F6IN/c10-8(11,12)5-2-1-4(3-17)7(16)6(5)9(13,14)15/h1-2H,3,17H2.
What are the key properties of [2-iodo-3,4-bis(trifluoromethyl)phenyl]methanamine?
[2-iodo-3,4-bis(trifluoromethyl)phenyl]methanamine has a molecular weight of 369.05 g/mol, XLogP of 3.79, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-iodo-3,4-bis(trifluoromethyl)phenyl]methanamine is sourced from PubChem (CID 134638419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).