C11H18N2O — CID 13464672
(E)-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]pent-3-enenitrile (PubChem CID 13464672) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is (E)-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]pent-3-enenitrile.
| Compound Name | (E)-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]pent-3-enenitrile |
|---|---|
| PubChem CID | 13464672 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | (E)-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]pent-3-enenitrile |
| SMILES | C/C=C/C(C#N)N1CCC[C@H]1COC |
| InChI | InChI=1S/C11H18N2O/c1-3-5-10(8-12)13-7-4-6-11(13)9-14-2/h3,5,10-11H,4,6-7,9H2,1-2H3/b5-3+/t10?,11-/m0/s1 |
| InChIKey | XLCGQDUHVNUSEQ-BJNYBMDKSA-N |
| XLogP | 1.57 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|