C16H32B2O4 — CID 13465330
4,4,5,5-tetramethyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-yl]-1,3,2-dioxaborolane (PubChem CID 13465330) has the molecular formula C16H32B2O4 and a molecular weight of 310.05 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 13465330 |
| Molecular Formula | C16H32B2O4 |
| Molecular Weight | 310.05 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-yl]-1,3,2-dioxaborolane |
| SMILES | CC(B1OC(C)(C)C(C)(C)O1)C(C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H32B2O4/c1-11(17-19-13(3,4)14(5,6)20-17)12(2)18-21-15(7,8)16(9,10)22-18/h11-12H,1-10H3 |
| InChIKey | XOMLJKKNYIWHGG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.05 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|