C12H9F4NO2S — CID 134655187
ethyl 2-[4-cyano-2-fluoro-6-(trifluoromethylsulfanyl)phenyl]acetate (PubChem CID 134655187) has the molecular formula C12H9F4NO2S and a molecular weight of 307.27 g/mol. Its IUPAC name is ethyl 2-[4-cyano-2-fluoro-6-(trifluoromethylsulfanyl)phenyl]acetate.
| Compound Name | ethyl 2-[4-cyano-2-fluoro-6-(trifluoromethylsulfanyl)phenyl]acetate |
|---|---|
| PubChem CID | 134655187 |
| Molecular Formula | C12H9F4NO2S |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | ethyl 2-[4-cyano-2-fluoro-6-(trifluoromethylsulfanyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1c(F)cc(C#N)cc1SC(F)(F)F |
| InChI | InChI=1S/C12H9F4NO2S/c1-2-19-11(18)5-8-9(13)3-7(6-17)4-10(8)20-12(14,15)16/h3-4H,2,5H2,1H3 |
| InChIKey | FMEZCLXJDPROMW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |