C12H11BrF2O5 — CID 134656662
2-[3-(3-bromopropanoyl)-5-(difluoromethoxy)phenyl]-2-hydroxyacetic acid (PubChem CID 134656662) has the molecular formula C12H11BrF2O5 and a molecular weight of 353.12 g/mol. Its IUPAC name is 2-[3-(3-bromopropanoyl)-5-(difluoromethoxy)phenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[3-(3-bromopropanoyl)-5-(difluoromethoxy)phenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 134656662 |
| Molecular Formula | C12H11BrF2O5 |
| Molecular Weight | 353.12 g/mol |
| Exact Mass | 351.98 |
| IUPAC Name | 2-[3-(3-bromopropanoyl)-5-(difluoromethoxy)phenyl]-2-hydroxyacetic acid |
| SMILES | O=C(CCBr)c1cc(OC(F)F)cc(C(O)C(=O)O)c1 |
| InChI | InChI=1S/C12H11BrF2O5/c13-2-1-9(16)6-3-7(10(17)11(18)19)5-8(4-6)20-12(14)15/h3-5,10,12,17H,1-2H2,(H,18,19) |
| InChIKey | OHOQGXVTFWMVPB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.12 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|