C11H13ClF2O4 — CID 143058060
2-[3-chloro-5-(difluoromethoxy)phenyl]-2-hydroxyacetic acid;ethane (PubChem CID 143058060) has the molecular formula C11H13ClF2O4 and a molecular weight of 282.67 g/mol. Its IUPAC name is 2-[3-chloro-5-(difluoromethoxy)phenyl]-2-hydroxyacetic acid;ethane.
| Compound Name | 2-[3-chloro-5-(difluoromethoxy)phenyl]-2-hydroxyacetic acid;ethane |
|---|---|
| PubChem CID | 143058060 |
| Molecular Formula | C11H13ClF2O4 |
| Molecular Weight | 282.67 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 2-[3-chloro-5-(difluoromethoxy)phenyl]-2-hydroxyacetic acid;ethane |
| SMILES | CC.O=C(O)C(O)c1cc(Cl)cc(OC(F)F)c1 |
| InChI | InChI=1S/C9H7ClF2O4.C2H6/c10-5-1-4(7(13)8(14)15)2-6(3-5)16-9(11)12;1-2/h1-3,7,9,13H,(H,14,15);1-2H3 |
| InChIKey | HERYLHVSEUVTJK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.67 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |