C11H13BrO3S — CID 134657497
2-[3-(3-bromopropyl)-2-sulfanylphenyl]-2-hydroxyacetic acid (PubChem CID 134657497) has the molecular formula C11H13BrO3S and a molecular weight of 305.19 g/mol. Its IUPAC name is 2-[3-(3-bromopropyl)-2-sulfanylphenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[3-(3-bromopropyl)-2-sulfanylphenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 134657497 |
| Molecular Formula | C11H13BrO3S |
| Molecular Weight | 305.19 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | 2-[3-(3-bromopropyl)-2-sulfanylphenyl]-2-hydroxyacetic acid |
| SMILES | O=C(O)C(O)c1cccc(CCCBr)c1S |
| InChI | InChI=1S/C11H13BrO3S/c12-6-2-4-7-3-1-5-8(10(7)16)9(13)11(14)15/h1,3,5,9,13,16H,2,4,6H2,(H,14,15) |
| InChIKey | SHQDJKCDLJXQRQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.19 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|