C11H11BrO4S — CID 134657561
2-[2-(3-bromo-2-oxopropyl)-3-sulfanylphenyl]-2-hydroxyacetic acid (PubChem CID 134657561) has the molecular formula C11H11BrO4S and a molecular weight of 319.18 g/mol. Its IUPAC name is 2-[2-(3-bromo-2-oxopropyl)-3-sulfanylphenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[2-(3-bromo-2-oxopropyl)-3-sulfanylphenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 134657561 |
| Molecular Formula | C11H11BrO4S |
| Molecular Weight | 319.18 g/mol |
| Exact Mass | 317.96 |
| IUPAC Name | 2-[2-(3-bromo-2-oxopropyl)-3-sulfanylphenyl]-2-hydroxyacetic acid |
| SMILES | O=C(CBr)Cc1c(S)cccc1C(O)C(=O)O |
| InChI | InChI=1S/C11H11BrO4S/c12-5-6(13)4-8-7(10(14)11(15)16)2-1-3-9(8)17/h1-3,10,14,17H,4-5H2,(H,15,16) |
| InChIKey | NXYCWKCXULACSX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.18 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|