C12H13BrO5 — CID 135740885
2-[2-(3-bromo-2-oxopropyl)-3-(hydroxymethyl)phenyl]-2-hydroxyacetic acid (PubChem CID 135740885) has the molecular formula C12H13BrO5 and a molecular weight of 317.14 g/mol. Its IUPAC name is 2-[2-(3-bromo-2-oxopropyl)-3-(hydroxymethyl)phenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[2-(3-bromo-2-oxopropyl)-3-(hydroxymethyl)phenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 135740885 |
| Molecular Formula | C12H13BrO5 |
| Molecular Weight | 317.14 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | 2-[2-(3-bromo-2-oxopropyl)-3-(hydroxymethyl)phenyl]-2-hydroxyacetic acid |
| SMILES | O=C(CBr)Cc1c(CO)cccc1C(O)C(=O)O |
| InChI | InChI=1S/C12H13BrO5/c13-5-8(15)4-10-7(6-14)2-1-3-9(10)11(16)12(17)18/h1-3,11,14,16H,4-6H2,(H,17,18) |
| InChIKey | GESGMYFYTDANFB-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.14 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|