C12H13ClO4 — CID 134657771
2-[2-(3-chloro-2-oxopropyl)-5-methylphenyl]-2-hydroxyacetic acid (PubChem CID 134657771) has the molecular formula C12H13ClO4 and a molecular weight of 256.69 g/mol. Its IUPAC name is 2-[2-(3-chloro-2-oxopropyl)-5-methylphenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[2-(3-chloro-2-oxopropyl)-5-methylphenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 134657771 |
| Molecular Formula | C12H13ClO4 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 2-[2-(3-chloro-2-oxopropyl)-5-methylphenyl]-2-hydroxyacetic acid |
| SMILES | Cc1ccc(CC(=O)CCl)c(C(O)C(=O)O)c1 |
| InChI | InChI=1S/C12H13ClO4/c1-7-2-3-8(5-9(14)6-13)10(4-7)11(15)12(16)17/h2-4,11,15H,5-6H2,1H3,(H,16,17) |
| InChIKey | CUNWMDYTAQQZPP-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|