C12H11ClF2O4 — CID 118812674
2-[4-(3-chloro-2-oxopropyl)-3-(difluoromethyl)phenyl]-2-hydroxyacetic acid (PubChem CID 118812674) has the molecular formula C12H11ClF2O4 and a molecular weight of 292.67 g/mol. Its IUPAC name is 2-[4-(3-chloro-2-oxopropyl)-3-(difluoromethyl)phenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[4-(3-chloro-2-oxopropyl)-3-(difluoromethyl)phenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 118812674 |
| Molecular Formula | C12H11ClF2O4 |
| Molecular Weight | 292.67 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 2-[4-(3-chloro-2-oxopropyl)-3-(difluoromethyl)phenyl]-2-hydroxyacetic acid |
| SMILES | O=C(CCl)Cc1ccc(C(O)C(=O)O)cc1C(F)F |
| InChI | InChI=1S/C12H11ClF2O4/c13-5-8(16)3-6-1-2-7(10(17)12(18)19)4-9(6)11(14)15/h1-2,4,10-11,17H,3,5H2,(H,18,19) |
| InChIKey | MNLKXXYBYGIWPC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.67 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|