C11H11ClO4 — CID 166641994
2-[3-(3-chloro-2-oxopropyl)phenyl]-2-hydroxyacetic acid (PubChem CID 166641994) has the molecular formula C11H11ClO4 and a molecular weight of 242.66 g/mol. Its IUPAC name is 2-[3-(3-chloro-2-oxopropyl)phenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[3-(3-chloro-2-oxopropyl)phenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 166641994 |
| Molecular Formula | C11H11ClO4 |
| Molecular Weight | 242.66 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 2-[3-(3-chloro-2-oxopropyl)phenyl]-2-hydroxyacetic acid |
| SMILES | O=C(CCl)Cc1cccc(C(O)C(=O)O)c1 |
| InChI | InChI=1S/C11H11ClO4/c12-6-9(13)5-7-2-1-3-8(4-7)10(14)11(15)16/h1-4,10,14H,5-6H2,(H,15,16) |
| InChIKey | YCXBQZOUMSBZLK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.66 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|