C8H4F4N2O2 — CID 134658688
2-[6-fluoro-3-hydroxy-4-(trifluoromethoxy)-2-pyridinyl]acetonitrile (PubChem CID 134658688) has the molecular formula C8H4F4N2O2 and a molecular weight of 236.12 g/mol. Its IUPAC name is 2-[6-fluoro-3-hydroxy-4-(trifluoromethoxy)-2-pyridinyl]acetonitrile.
| Compound Name | 2-[6-fluoro-3-hydroxy-4-(trifluoromethoxy)-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 134658688 |
| Molecular Formula | C8H4F4N2O2 |
| Molecular Weight | 236.12 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 2-[6-fluoro-3-hydroxy-4-(trifluoromethoxy)-2-pyridinyl]acetonitrile |
| SMILES | N#CCc1nc(F)cc(OC(F)(F)F)c1O |
| InChI | InChI=1S/C8H4F4N2O2/c9-6-3-5(16-8(10,11)12)7(15)4(14-6)1-2-13/h3,15H,1H2 |
| InChIKey | OZJSCDAGQNFBQZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 66.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.12 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|