C10H8F4N2O2 — CID 134682687
2-[5-(fluoromethyl)-6-methoxy-3-(trifluoromethoxy)-2-pyridinyl]acetonitrile (PubChem CID 134682687) has the molecular formula C10H8F4N2O2 and a molecular weight of 264.18 g/mol. Its IUPAC name is 2-[5-(fluoromethyl)-6-methoxy-3-(trifluoromethoxy)-2-pyridinyl]acetonitrile.
| Compound Name | 2-[5-(fluoromethyl)-6-methoxy-3-(trifluoromethoxy)-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 134682687 |
| Molecular Formula | C10H8F4N2O2 |
| Molecular Weight | 264.18 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 2-[5-(fluoromethyl)-6-methoxy-3-(trifluoromethoxy)-2-pyridinyl]acetonitrile |
| SMILES | COc1nc(CC#N)c(OC(F)(F)F)cc1CF |
| InChI | InChI=1S/C10H8F4N2O2/c1-17-9-6(5-11)4-8(18-10(12,13)14)7(16-9)2-3-15/h4H,2,5H2,1H3 |
| InChIKey | QJFYTFVESHHHLF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.18 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |