C8H6F5IN2O — CID 134660996
[5-(difluoromethyl)-4-iodo-2-(trifluoromethoxy)-3-pyridinyl]methanamine (PubChem CID 134660996) has the molecular formula C8H6F5IN2O and a molecular weight of 368.04 g/mol. Its IUPAC name is [5-(difluoromethyl)-4-iodo-2-(trifluoromethoxy)-3-pyridinyl]methanamine.
| Compound Name | [5-(difluoromethyl)-4-iodo-2-(trifluoromethoxy)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 134660996 |
| Molecular Formula | C8H6F5IN2O |
| Molecular Weight | 368.04 g/mol |
| Exact Mass | 367.94 |
| IUPAC Name | [5-(difluoromethyl)-4-iodo-2-(trifluoromethoxy)-3-pyridinyl]methanamine |
| SMILES | NCc1c(OC(F)(F)F)ncc(C(F)F)c1I |
| InChI | InChI=1S/C8H6F5IN2O/c9-6(10)4-2-16-7(17-8(11,12)13)3(1-15)5(4)14/h2,6H,1,15H2 |
| InChIKey | NRVFFSQQSGKLEQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.04 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|