C11H9ClF5NO2 — CID 134662366
ethyl 2-[3-chloro-5-(difluoromethyl)-2-(trifluoromethyl)-4-pyridinyl]acetate (PubChem CID 134662366) has the molecular formula C11H9ClF5NO2 and a molecular weight of 317.64 g/mol. Its IUPAC name is ethyl 2-[3-chloro-5-(difluoromethyl)-2-(trifluoromethyl)-4-pyridinyl]acetate.
| Compound Name | ethyl 2-[3-chloro-5-(difluoromethyl)-2-(trifluoromethyl)-4-pyridinyl]acetate |
|---|---|
| PubChem CID | 134662366 |
| Molecular Formula | C11H9ClF5NO2 |
| Molecular Weight | 317.64 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | ethyl 2-[3-chloro-5-(difluoromethyl)-2-(trifluoromethyl)-4-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1c(C(F)F)cnc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C11H9ClF5NO2/c1-2-20-7(19)3-5-6(10(13)14)4-18-9(8(5)12)11(15,16)17/h4,10H,2-3H2,1H3 |
| InChIKey | RPJKMCJEOGBXRO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.64 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |