C9H4BrClF5NO2 — CID 134662816
5-(bromomethyl)-4-(difluoromethyl)-6-(trifluoromethoxy)pyridine-3-carbonyl chloride (PubChem CID 134662816) has the molecular formula C9H4BrClF5NO2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 5-(bromomethyl)-4-(difluoromethyl)-6-(trifluoromethoxy)pyridine-3-carbonyl chloride.
| Compound Name | 5-(bromomethyl)-4-(difluoromethyl)-6-(trifluoromethoxy)pyridine-3-carbonyl chloride |
|---|---|
| PubChem CID | 134662816 |
| Molecular Formula | C9H4BrClF5NO2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 366.90 |
| IUPAC Name | 5-(bromomethyl)-4-(difluoromethyl)-6-(trifluoromethoxy)pyridine-3-carbonyl chloride |
| SMILES | O=C(Cl)c1cnc(OC(F)(F)F)c(CBr)c1C(F)F |
| InChI | InChI=1S/C9H4BrClF5NO2/c10-1-3-5(7(12)13)4(6(11)18)2-17-8(3)19-9(14,15)16/h2,7H,1H2 |
| InChIKey | BJZVEZUBFAEZRD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|